Difference between revisions of "DIHYDRONEOPTERIN-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_002530 == * left end position: ** 2652481 * transcription direction: ** NEGATIVE * right end position: ** 2660149 * centisome position: ** 42.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == * smiles: ** CC(C)C(=C)CCC(C)[CH]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-METHYL-5-ALPHA-ERGOSTA ALPHA-METHYL-5-ALPHA-ERGOSTA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N |
| − | * | + | * common name: |
| − | ** | + | ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 410.682 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-4144]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[1.14.13.70-RXN]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203414 25203414] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30109 30109] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11508 C11508] |
| − | {{#set: | + | * HMDB : HMDB06928 |
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N}} | ||
| + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol}} | ||
| + | {{#set: molecular weight=410.682 }} | ||
| + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol}} | ||
| + | {{#set: consumed by=RXN-4144}} | ||
| + | {{#set: produced by=1.14.13.70-RXN}} | ||
Revision as of 13:41, 21 March 2018
Contents
Metabolite ALPHA-METHYL-5-ALPHA-ERGOSTA
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=HLAWVOWADPNAGN-BAHZUFOISA-N
- common name:
- 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol
- molecular weight:
- 410.682
- Synonym(s):
- 4α-methyl-5α-ergosta-8,14,24(241)-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
