Difference between revisions of "RXN-12872"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J |
* common name: | * common name: | ||
− | ** | + | ** dGTP |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 503.152 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxyguanosine-5'-triphosphate | ||
+ | ** deoxy-GTP | ||
+ | ** deoxyguanosine-triphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14217]] |
+ | * [[RXN-14208]] | ||
+ | * [[RXN0-385]] | ||
+ | * [[RXN-11410]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-746]] | ||
+ | * [[DGDPKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-14207]] |
== External links == | == External links == | ||
+ | * CAS : 2564-35-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112] |
+ | * HMDB : HMDB01440 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429] |
− | * | + | * BIGG : 34502 |
− | {{#set: smiles=C(O) | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}} |
− | {{#set: common name= | + | {{#set: common name=dGTP}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=503.152 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}} |
− | {{#set: reversible reaction associated=RXN- | + | {{#set: consumed by=RXN-14217|RXN-14208|RXN0-385|RXN-11410}} |
+ | {{#set: produced by=RXN0-746|DGDPKIN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-14207}} |
Revision as of 14:41, 21 March 2018
Contents
Metabolite DGTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
- common name:
- dGTP
- molecular weight:
- 503.152
- Synonym(s):
- 2'-deoxyguanosine-5'-triphosphate
- deoxy-GTP
- deoxyguanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.