Difference between revisions of "Trans-3-enoyl-CoAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N |
* common name: | * common name: | ||
− | ** | + | ** keto-D-fructose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14515]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-7644]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] |
− | {{#set: smiles=C(O) | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC48095 |
− | {{#set: molecular weight= | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} |
− | {{#set: | + | {{#set: common name=keto-D-fructose}} |
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: consumed by=RXN-14515}} | ||
+ | {{#set: reversible reaction associated=RXN-7644}} |
Revision as of 13:41, 21 March 2018
Contents
Metabolite CPD-15382
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
- common name:
- keto-D-fructose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links