Difference between revisions of "CPD-15301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA N-ACETYL-BETA-D-GLUCOSAMINYL-13-ETCETERA] == * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == |
| + | * smiles: | ||
| + | ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** porifersta-5,7-dienol |
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 24S-ethylcholesta-5,7-dien-3β-ol |
| + | ** 7-dehydroclionasterol | ||
| + | ** moonisterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13892]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 24057-73-6 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16058079 16058079] |
| − | {{#set: produced by= | + | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| + | {{#set: inchi key=InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N}} | ||
| + | {{#set: common name=porifersta-5,7-dienol}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: common name=24S-ethylcholesta-5,7-dien-3β-ol|7-dehydroclionasterol|moonisterol}} | ||
| + | {{#set: produced by=RXN-13892}} | ||
Revision as of 13:42, 21 March 2018
Contents
Metabolite CPD-14900
- smiles:
- CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ARVGMISWLZPBCH-WGDHXTRRSA-N
- common name:
- porifersta-5,7-dienol
- molecular weight:
- 412.698
- Synonym(s):
- 24S-ethylcholesta-5,7-dien-3β-ol
- 7-dehydroclionasterol
- moonisterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 24057-73-6
- PUBCHEM:
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
