Difference between revisions of "BENZALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerols Triacylglycerols] == * common name: ** a triacyl-sn-glycerol * Synonym(s): ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * inchi key: ** InC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == |
| + | * smiles: | ||
| + | ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** sinapaldehyde |
| + | * molecular weight: | ||
| + | ** 208.213 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1125]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-1143]] | |
| − | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-1124]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280802 5280802] |
| − | {{#set: reversible reaction associated=RXN- | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.4444359.html 4444359] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27949 27949] | ||
| + | * METABOLIGHTS : MTBLC27949 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05610 C05610] | ||
| + | {{#set: smiles=COC1(C=C(C=CC=O)C=C(OC)C(O)=1)}} | ||
| + | {{#set: inchi key=InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N}} | ||
| + | {{#set: common name=sinapaldehyde}} | ||
| + | {{#set: molecular weight=208.213 }} | ||
| + | {{#set: consumed by=RXN-1125}} | ||
| + | {{#set: produced by=RXN-1143}} | ||
| + | {{#set: reversible reaction associated=RXN-1124}} | ||
Revision as of 13:42, 21 March 2018
Contents
Metabolite SINAPALDEHYDE
- smiles:
- COC1(C=C(C=CC=O)C=C(OC)C(O)=1)
- inchi key:
- InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N
- common name:
- sinapaldehyde
- molecular weight:
- 208.213
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
