Difference between revisions of "6.3.5.6-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] == * direction: ** REVERSIBLE * common name: ** isovaleryl-CoA dehydrogenase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14264 RXN-14264] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
 
* common name:
 
* common name:
−
** isovaleryl-CoA dehydrogenase
+
** 6-cis, 2-trans-tridecadienoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.8.4 EC-1.3.8.4]
+
** 955.803   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z, 2E-tridecadienoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ISOVALERYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[FAD]][c] '''<=>''' 1 [[FADH2]][c] '''+''' 1 [[3-METHYL-CROTONYL-COA]][c]
+
* [[RXN-14771]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 isovaleryl-CoA[c] '''+''' 1 H+[c] '''+''' 1 FAD[c] '''<=>''' 1 FADH2[c] '''+''' 1 3-methylcrotonyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-14_006780]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-08_006390]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-03_003490]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31064 31064]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
−
* LIGAND-RXN:
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04095 R04095]
+
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
−
{{#set: common name=isovaleryl-CoA dehydrogenase}}
+
{{#set: molecular weight=955.803    }}
−
{{#set: ec number=EC-1.3.8.4}}
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
−
{{#set: gene associated=Ec-14_006780|Ec-08_006390|Ec-03_003490}}
+
{{#set: produced by=RXN-14771}}
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Revision as of 13:42, 21 March 2018

Metabolite CPD-15666

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
  • common name:
    • 6-cis, 2-trans-tridecadienoyl-CoA
  • molecular weight:
    • 955.803
  • Synonym(s):
    • 6Z, 2E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=6.3.5.6-RXN&oldid=20974"