Difference between revisions of "Ec-01 006480"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-25_003160 == * left end position: ** 3530050 * transcription direction: ** POSITIVE * right end position: ** 3556672 * centisome position: ** 79.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * inchi key: ** InChIKey=YAVLYBVKPX...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-25_003160 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] ==
−
* left end position:
+
* smiles:
−
** 3530050
+
** C([N+])CC[N+]=CCCC[N+]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
−
* right end position:
+
* common name:
−
** 3556672
+
** dehydrospermidine
−
* centisome position:
+
* molecular weight:
−
** 79.31025    
+
** 146.255    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0268_0033
 
−
** Esi0268_0033
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.6.3.1-RXN]]
+
* [[RXN-13415]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN-13414]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3530050}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746]
−
{{#set: right end position=3556672}}
+
* CHEBI:
−
{{#set: centisome position=79.31025   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732]
−
{{#set: common name=Esi_0268_0033|Esi0268_0033}}
+
* METABOLIGHTS : MTBLC58732
−
{{#set: reaction associated=3.6.3.1-RXN}}
+
{{#set: smiles=C([N+])CC[N+]=CCCC[N+]}}
 +
{{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}}
 +
{{#set: common name=dehydrospermidine}}
 +
{{#set: molecular weight=146.255   }}
 +
{{#set: consumed by=RXN-13415}}
 +
{{#set: produced by=RXN-13414}}

Revision as of 13:43, 21 March 2018

Metabolite CPD-14378

  • smiles:
    • C([N+])CC[N+]=CCCC[N+]
  • inchi key:
    • InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
  • common name:
    • dehydrospermidine
  • molecular weight:
    • 146.255
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006480&oldid=20994"