Difference between revisions of "HOMO-CIT"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RH-Group RH-Group] == * common name: ** an organic molecule * Synonym(s): ** an organic compoun...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == * smiles: ** CC(C)C([N+])C([O-])=O * inchi key: ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCN...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VAL VAL] == |
| + | * smiles: | ||
| + | ** CC(C)C([N+])C([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** L-valine |
| + | * molecular weight: | ||
| + | ** 117.147 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** V |
| + | ** val | ||
| + | ** valine | ||
| + | ** L-val | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[VALINE--TRNA-LIGASE-RXN]] |
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 72-18-4 |
| − | {{#set: common name= | + | * BIGG : 34167 |
| − | {{#set: consumed by= | + | * PUBCHEM: |
| − | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971018 6971018] |
| + | * HMDB : HMDB00883 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00183 C00183] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57762 57762] | ||
| + | * METABOLIGHTS : MTBLC57762 | ||
| + | {{#set: smiles=CC(C)C([N+])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N}} | ||
| + | {{#set: common name=L-valine}} | ||
| + | {{#set: molecular weight=117.147 }} | ||
| + | {{#set: common name=V|val|valine|L-val}} | ||
| + | {{#set: consumed by=VALINE--TRNA-LIGASE-RXN|biomass_rxn}} | ||
| + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERVAL-RXN}} | ||
Revision as of 13:43, 21 March 2018
Contents
Metabolite VAL
- smiles:
- CC(C)C([N+])C([O-])=O
- inchi key:
- InChIKey=KZSNJWFQEVHDMF-BYPYZUCNSA-N
- common name:
- L-valine
- molecular weight:
- 117.147
- Synonym(s):
- V
- val
- valine
- L-val
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 72-18-4
- BIGG : 34167
- PUBCHEM:
- HMDB : HMDB00883
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57762
"CC(C)C([N+])C([O-])=O" cannot be used as a page name in this wiki.
