Difference between revisions of "PHENYLALANINE--TRNA-LIGASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == * smiles: ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J |
* common name: | * common name: | ||
− | ** | + | ** 8-oxo-dGTP |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 519.151 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 8-oxo-7,8-dihydro-2'-dGTP |
− | ** | + | ** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11410]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-14205]] |
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896] |
− | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}} | |
− | + | {{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}} | |
− | + | {{#set: common name=8-oxo-dGTP}} | |
− | {{#set: smiles=C( | + | {{#set: molecular weight=519.151 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-11410}} |
− | {{#set: molecular weight= | + | {{#set: reversible reaction associated=RXN-14205}} |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: produced by= | + | |
− | {{#set: reversible reaction associated= | + |
Revision as of 13:43, 21 March 2018
Contents
Metabolite CPD0-1905
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
- common name:
- 8-oxo-dGTP
- molecular weight:
- 519.151
- Synonym(s):
- 8-oxo-7,8-dihydro-2'-dGTP
- 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.