Difference between revisions of "CPD-195"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] == * smiles: ** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C...")
(Created page with "Category:Gene == Gene Ec-16_005210 == * left end position: ** 5332874 * transcription direction: ** NEGATIVE * right end position: ** 5335449 * centisome position: ** 99.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMNH2 FMNH2] ==
+
== Gene Ec-16_005210 ==
−
* smiles:
+
* left end position:
−
** CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))
+
** 5332874
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** FMNH2
+
** 5335449
−
* molecular weight:
+
* centisome position:
−
** 456.348    
+
** 99.910446    
 
* Synonym(s):
 
* Synonym(s):
−
** Reduced FMN
+
** Esi_0334_0032
−
** reduced flavin mononucleotide
+
** Esi0334_0032
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
* [[RXN-9510]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* CAS : 5666-16-0
+
{{#set: left end position=5332874}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229161 44229161]
+
{{#set: right end position=5335449}}
−
* HMDB : HMDB01142
+
{{#set: centisome position=99.910446   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0334_0032|Esi0334_0032}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01847 C01847]
+
{{#set: reaction associated=RXN-15556}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7511}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57618 57618]
+
−
* BIGG : 1489679
+
−
{{#set: smiles=CC2(=CC1(NC3(C(=O)NC(=O)NC(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)=3)))}}
+
−
{{#set: inchi key=InChIKey=YTNIXZGTHTVJBW-SCRDCRAPSA-L}}
+
−
{{#set: common name=FMNH2}}
+
−
{{#set: molecular weight=456.348   }}
+
−
{{#set: common name=Reduced FMN|reduced flavin mononucleotide}}
+
−
{{#set: produced by=RXN-9510}}
+

Revision as of 13:43, 21 March 2018

Gene Ec-16_005210

  • left end position:
    • 5332874
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5335449
  • centisome position:
    • 99.910446
  • Synonym(s):
    • Esi_0334_0032
    • Esi0334_0032

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-195&oldid=21094"