Difference between revisions of "Ec-12 001530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-05_003910 == * left end position: ** 5880978 * transcription direction: ** NEGATIVE * right end position: ** 5896653 * centisome position: ** 64.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-05_003910 == |
− | * | + | * left end position: |
− | ** | + | ** 5880978 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5896653 |
− | * | + | * centisome position: |
− | ** | + | ** 64.60126 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0043_0147 | ||
+ | ** Esi0043_0147 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.5.1.98-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=5880978}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5896653}} | |
− | + | {{#set: centisome position=64.60126 }} | |
− | + | {{#set: common name=Esi_0043_0147|Esi0043_0147}} | |
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:43, 21 March 2018
Gene Ec-05_003910
- left end position:
- 5880978
- transcription direction:
- NEGATIVE
- right end position:
- 5896653
- centisome position:
- 64.60126
- Synonym(s):
- Esi_0043_0147
- Esi0043_0147
Reactions associated
- Reaction: 3.5.1.98-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome