Difference between revisions of "CPD1F-126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12653 CPD-12653] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)[O-] * common name: ** stearidon...") |
(Created page with "Category:Gene == Gene Ec-17_000400 == * left end position: ** 368939 * transcription direction: ** POSITIVE * right end position: ** 377947 * centisome position: ** 7.6895...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_000400 == |
− | * | + | * left end position: |
− | ** | + | ** 368939 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 377947 |
− | * | + | * centisome position: |
− | ** | + | ** 7.689518 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0016_0184 |
− | ** | + | ** Esi0016_0184 |
− | ** | + | ** FKB6 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=368939}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=377947}} | |
− | + | {{#set: centisome position=7.689518 }} | |
− | + | {{#set: common name=Esi_0016_0184|Esi0016_0184|FKB6}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:43, 21 March 2018
Gene Ec-17_000400
- left end position:
- 368939
- transcription direction:
- POSITIVE
- right end position:
- 377947
- centisome position:
- 7.689518
- Synonym(s):
- Esi_0016_0184
- Esi0016_0184
- FKB6
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome