Difference between revisions of "Ec-07 007360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
(Created page with "Category:Gene == Gene Ec-19_004150 == * Synonym(s): ** Esi_0278_0031 ** Esi0278_0031 ** Nrt2;2 == Reactions associated == * Reaction: TCV3 ** Source: orthology-arag...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Gene Ec-19_004150 ==
−
* smiles:
+
−
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
−
* common name:
+
−
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
−
* molecular weight:
+
−
** 211.045   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
+
** Esi_0278_0031
−
** 2-oxo-3-hydroxy-4-phosphobutanoate
+
** Esi0278_0031
 +
** Nrt2;2
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TCV3]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
−
* [[PSERTRANSAMPYR-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0278_0031|Esi0278_0031|Nrt2;2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
{{#set: reaction associated=TCV3}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
−
* BIGG : 1447403
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
−
* HMDB : HMDB06801
+
−
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
−
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
−
{{#set: molecular weight=211.045    }}
+
−
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
−
{{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}}
+

Revision as of 13:44, 21 March 2018

Gene Ec-19_004150

  • Synonym(s):
    • Esi_0278_0031
    • Esi0278_0031
    • Nrt2;2

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_007360&oldid=21217"