Difference between revisions of "RXN-16616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(C(O)C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Ec-01_003190 == * left end position: ** 2718272 * transcription direction: ** NEGATIVE * right end position: ** 2719816 * centisome position: ** 26.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_003190 == |
− | * | + | * left end position: |
− | ** | + | ** 2718272 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2719816 |
− | * | + | * centisome position: |
− | ** | + | ** 26.342821 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0003_0205 |
+ | ** Esi0003_0205 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | * | + | == Pathways associated == |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2718272}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2719816}} | |
− | + | {{#set: centisome position=26.342821 }} | |
− | + | {{#set: common name=Esi_0003_0205|Esi0003_0205}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:44, 21 March 2018
Gene Ec-01_003190
- left end position:
- 2718272
- transcription direction:
- NEGATIVE
- right end position:
- 2719816
- centisome position:
- 26.342821
- Synonym(s):
- Esi_0003_0205
- Esi0003_0205
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome