Difference between revisions of "Ec-06 009490"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-KINASE-RXN PSEUDOURIDINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP([O-])(=O)[O-])C(O)CO |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L |
+ | * common name: | ||
+ | ** sn-glycerol 1-phosphate | ||
+ | * molecular weight: | ||
+ | ** 170.058 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-glycerol 3-phosphate | ||
+ | ** L-glycerol 1-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.5.1.41-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048685 7048685] |
− | * LIGAND- | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.chemspider.com/Chemical-Structure.5408879.html 5408879] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57685 57685] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00623 C00623] |
− | {{#set: | + | {{#set: smiles=C(OP([O-])(=O)[O-])C(O)CO}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L}} |
+ | {{#set: common name=sn-glycerol 1-phosphate}} | ||
+ | {{#set: molecular weight=170.058 }} | ||
+ | {{#set: common name=D-glycerol 3-phosphate|L-glycerol 1-phosphate}} | ||
+ | {{#set: consumed by=2.5.1.41-RXN}} |
Revision as of 13:44, 21 March 2018
Contents
Metabolite SN-GLYCEROL-1-PHOSPHATE
- smiles:
- C(OP([O-])(=O)[O-])C(O)CO
- inchi key:
- InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L
- common name:
- sn-glycerol 1-phosphate
- molecular weight:
- 170.058
- Synonym(s):
- D-glycerol 3-phosphate
- L-glycerol 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C(O)CO" cannot be used as a page name in this wiki.