Difference between revisions of "RXN1G-368"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-163 RXN1F-163] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-163 RXN1F-163] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
−
* common name:
+
−
** sn-glycerol 1-phosphate
+
−
* molecular weight:
+
−
** 170.058   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-glycerol 3-phosphate
 
−
** L-glycerol 1-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.5.1.41-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-97]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CPD1F-120]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 gibberellin A15 (open lactone form)[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 gibberellin A24[c] '''+''' 1 succinate[c] '''+''' 1 CO2[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5070]], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048685 7048685]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06323 R06323]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.5408879.html 5408879]
+
{{#set: ec number=EC-1.14.11}}
−
* CHEBI:
+
{{#set: gene associated=Ec-08_003510|Ec-19_002750|Ec-19_002760}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57685 57685]
+
{{#set: in pathway=PWY-5070}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00623 C00623]
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C(O)CO}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=AWUCVROLDVIAJX-VKHMYHEASA-L}}
+
−
{{#set: common name=sn-glycerol 1-phosphate}}
+
−
{{#set: molecular weight=170.058    }}
+
−
{{#set: common name=D-glycerol 3-phosphate|L-glycerol 1-phosphate}}
+
−
{{#set: consumed by=2.5.1.41-RXN}}
+

Revision as of 13:44, 21 March 2018

Reaction RXN1F-163

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5070, gibberellin biosynthesis I (non C-3, non C-13 hydroxylation): PWY-5070
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-368&oldid=21226"