Difference between revisions of "CH33ADO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10727 RXN-10727] == * direction: ** LEFT-TO-RIGHT * common name: ** myristoyl-ACP hydrolase act...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10727 RXN-10727] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
 +
* inchi key:
 +
** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
 
* common name:
 
* common name:
−
** myristoyl-ACP hydrolase activity
+
** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.2.14 EC-3.1.2.14]
+
** 492.298   
 
* Synonym(s):
 
* Synonym(s):
−
** myristoyl-[acyl-carrier protein] hydrolase activity
+
** iPDP
−
** myristoyl-ACP hydrolase activity
+
** isopentenyladenosine riboside-5'-diphosphate
−
** tetradecanoyl-[acyl-carrier-protein] hydrolase activity
+
** iPRDP
−
** tetradecanoyl-ACP hydrolase activity
+
** isopentenyladenosine-5'-diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-7836]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ACP]][c]
+
* [[RXN-4305]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a myristoyl-[acp][c] '''+''' 1 H2O[c] '''=>''' 1 myristate[c] '''+''' 1 H+[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[gap-filling]]
+
−
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
−
*** Tool: [[meneco]]
+
−
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30126 30126]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08159 R08159]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=myristoyl-ACP hydrolase activity}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426]
−
{{#set: ec number=EC-3.1.2.14}}
+
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}}
−
{{#set: common name=myristoyl-[acyl-carrier protein] hydrolase activity|myristoyl-ACP hydrolase activity|tetradecanoyl-[acyl-carrier-protein] hydrolase activity|tetradecanoyl-ACP hydrolase activity}}
+
{{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}}
−
{{#set: in pathway=}}
+
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}}
−
{{#set: reconstruction category=gap-filling}}
+
{{#set: molecular weight=492.298    }}
−
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
{{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}}
−
{{#set: reconstruction tool=meneco}}
+
{{#set: produced by=RXN-4305}}
−
{{#set: reconstruction comment=added for gapfilling}}
+

Revision as of 13:44, 21 March 2018

Metabolite CPD-4203

  • smiles:
    • CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
  • inchi key:
    • InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
  • common name:
    • N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
  • molecular weight:
    • 492.298
  • Synonym(s):
    • iPDP
    • isopentenyladenosine riboside-5'-diphosphate
    • iPRDP
    • isopentenyladenosine-5'-diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CH33ADO&oldid=21239"