|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALATE-DEH-RXN MALATE-DEH-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARATE COUMARATE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(=O)([O-])C=CC1(=CC=C(O)C=C1) |
| + | * inchi key: |
| + | ** InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M |
| * common name: | | * common name: |
− | ** Lactate/malate dehydrogenase, C-terminal | + | ** 4-coumarate |
− | ** Lactate dehydrogenase/glycoside hydrolase, family 4, C-terminal
| + | * molecular weight: |
− | * ec number: | + | ** 163.152 |
− | ** [http://enzyme.expasy.org/EC/1.1.1.37 EC-1.1.1.37] | + | |
| * Synonym(s): | | * Synonym(s): |
− | ** malate dehydrogenation | + | ** 4-hydroxycinnamate |
| + | ** 4-hydroxycinnamic acid |
| + | ** p-coumarate |
| + | ** trans-4-hydroxycinnamate |
| + | ** p-coumaric acid |
| + | ** trans-p-hydroxycinnamate |
| + | ** trans-4-coumarate |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | ** 1 [[NAD]][c] '''+''' 1 [[MAL]][c] '''<=>''' 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 NAD+[c] '''+''' 1 (S)-malate[c] '''<=>''' 1 oxaloacetate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
| + | |
− | | + | |
− | == Genes associated with this reaction ==
| + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-10_006200]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | * [[Ec-02_003100]]
| + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | ** [[pantograph]]-[[aragem]]
| + | |
− | == Pathways ==
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''8''' reactions found over '''16''' reactions in the full pathway
| + | |
− | * [[PWY-561]], superpathway of glyoxylate cycle and fatty acid degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-561 PWY-561]
| + | |
− | ** '''6''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-1622]], formaldehyde assimilation I (serine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1622 PWY-1622] | + | |
− | ** '''6''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[GLUCONEO-PWY]], gluconeogenesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUCONEO-PWY GLUCONEO-PWY]
| + | |
− | ** '''13''' reactions found over '''13''' reactions in the full pathway
| + | |
− | * [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY]
| + | |
− | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7383]], anaerobic energy metabolism (invertebrates, cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7383 PWY-7383]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
| + | |
− | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
| + | |
− | ** '''6''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''9''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
| + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[P108-PWY]], pyruvate fermentation to propanoate I: [http://metacyc.org/META/NEW-IMAGE?object=P108-PWY P108-PWY]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[MALATE-ASPARTATE-SHUTTLE-PWY]], L-aspartate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=MALATE-ASPARTATE-SHUTTLE-PWY MALATE-ASPARTATE-SHUTTLE-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| + | |
− | ** '''10''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY66-399]], gluconeogenesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-399 PWY66-399]
| + | |
− | ** '''10''' reactions found over '''12''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-aragem]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 7400-08-0 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21432 21432]
| + | * PUBCHEM: |
− | * PIR:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54708745 54708745] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A32472 A32472]
| + | * HMDB : HMDB02035 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A49496 A49496]
| + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A60689 A60689] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00811 C00811] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C64110 C64110] | + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D81399 D81399]
| + | ** [http://www.chemspider.com/Chemical-Structure.4450678.html 4450678] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEBYMC DEBYMC]
| + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEBYMM DEBYMM] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12876 12876] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEBYMP DEBYMP]
| + | * METABOLIGHTS : MTBLC12876 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEEBM DEEBM]
| + | {{#set: smiles=C(=O)([O-])C=CC1(=CC=C(O)C=C1)}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEECM DEECM]
| + | {{#set: inchi key=InChIKey=NGSWKAQJJWESNS-ZZXKWVIFSA-M}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEMSMC DEMSMC]
| + | {{#set: common name=4-coumarate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEMSMM DEMSMM]
| + | {{#set: molecular weight=163.152 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEPGMM DEPGMM]
| + | {{#set: common name=4-hydroxycinnamate|4-hydroxycinnamic acid|p-coumarate|trans-4-hydroxycinnamate|p-coumaric acid|trans-p-hydroxycinnamate|trans-4-coumarate}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEPUGW DEPUGW]
| + | {{#set: consumed by=4-COUMARATE--COA-LIGASE-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DEPUMW DEPUMW]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DERTMM DERTMM]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DETWMA DETWMA]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=F85551 F85551]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G01650 G01650]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H64477 H64477]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40383 I40383]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PA0040 PA0040]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PA0079 PA0079]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=PN0162 PN0162]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S03352 S03352]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S03958 S03958]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04956 S04956]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04957 S04957]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04958 S04958]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04959 S04959]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04960 S04960]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S04961 S04961]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S07574 S07574]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S08981 S08981]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S44167 S44167]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S52039 S52039]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S57958 S57958]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S61213 S61213]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S75735 S75735]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T03272 T03272]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06325 T06325]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06326 T06326]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06327 T06327]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06328 T06328]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T06386 T06386]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08015 T08015]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08077 T08077]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T08177 T08177]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09228 T09228]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09263 T09263]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09286 T09286]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09291 T09291]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09294 T09294]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T12433 T12433]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T18570 T18570]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T45206 T45206]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T45208 T45208]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T49932 T49932]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T51311 T51311]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T51862 T51862]
| + | |
− | * LIGAND-RXN: | + | |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00342 R00342] | + | |
− | * UNIPROT: | + | |
− | ** [http://www.uniprot.org/uniprot/Q07841 Q07841] | + | |
− | ** [http://www.uniprot.org/uniprot/P33163 P33163]
| + | |
− | ** [http://www.uniprot.org/uniprot/P44427 P44427] | + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHY2 Q9PHY2] | + | |
− | ** [http://www.uniprot.org/uniprot/P22133 P22133]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17505 P17505]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32419 P32419] | + | |
− | ** [http://www.uniprot.org/uniprot/P25077 P25077]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14152 P14152]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8R1P0 Q8R1P0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19446 P19446]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17783 P17783]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04636 P04636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P58408 P58408]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58820 Q58820]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49814 P49814]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q93ZA7 Q93ZA7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Y9 Q7M4Y9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M4Z0 Q7M4Z0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10887 P10887]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11386 P11386]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19983 P19983]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19981 P19981]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19979 P19979]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19977 P19977]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19982 P19982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19978 P19978]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19980 P19980]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16142 P16142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46487 P46487]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46488 P46488]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43744 Q43744]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59202 Q59202]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55383 Q55383]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42972 Q42972]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81278 O81278]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81279 O81279]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65363 O65363]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65364 O65364]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81609 O81609]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43743 Q43743]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42686 Q42686]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93106 P93106]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04820 Q04820]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48903 O48903]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48904 O48904]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48905 O48905]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48906 O48906]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24047 O24047]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XTB4 Q9XTB4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50917 P50917]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49981 Q49981]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZP05 Q9ZP05]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZP06 Q9ZP06]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SN86 Q9SN86]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=Lactate/malate dehydrogenase, C-terminal}} | + | |
− | {{#set: common name=Lactate dehydrogenase/glycoside hydrolase, family 4, C-terminal}} | + | |
− | {{#set: ec number=EC-1.1.1.37}} | + | |
− | {{#set: common name=malate dehydrogenation}} | + | |
− | {{#set: gene associated=Ec-10_006200|Ec-02_003100}}
| + | |
− | {{#set: in pathway=FERMENTATION-PWY|PWY-561|PWY-5913|PWY-1622|GLUCONEO-PWY|P42-PWY|PWY-7383|PWY-5690|PWY-5392|TCA|P23-PWY|P105-PWY|GLYOXYLATE-BYPASS|PWY-6969|PWY-6728|PWY-7115|P108-PWY|MALATE-ASPARTATE-SHUTTLE-PWY|PWY66-398|PWY66-399}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
| + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |