Difference between revisions of "Ec-07 006540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9548 RXN-9548] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9548 RXN-9548] ==
−
* smiles:
+
* direction:
−
** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
+
** [http://enzyme.expasy.org/EC/3.1.2.14 EC-3.1.2.14]
−
* common name:
+
−
** FADH2
+
−
* molecular weight:
+
−
** 785.556   
+
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide reduced
 
−
** 1,5-dihydro-FAD
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[MEPROPCOA-FAD-RXN]]
+
** 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[STEARIC_ACID]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-14264]]
+
** 1 a stearoyl-[acp][c] '''+''' 1 H2O[c] '''=>''' 1 H+[c] '''+''' 1 stearate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1910-41-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: ec number=EC-3.1.2.14}}
−
* BIGG : 132077
+
{{#set: in pathway=PWY-5989}}
−
* PUBCHEM:
+
{{#set: reconstruction category=gap-filling}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118]
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
* HMDB : HMDB01197
+
{{#set: reconstruction tool=meneco}}
−
* LIGAND-CPD:
+
{{#set: reconstruction comment=added for gapfilling}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307]
+
−
* METABOLIGHTS : MTBLC58307
+
−
{{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}}
+
−
{{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}}
+
−
{{#set: common name=FADH2}}
+
−
{{#set: molecular weight=785.556    }}
+
−
{{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}}
+
−
{{#set: produced by=MEPROPCOA-FAD-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14264}}
+

Revision as of 13:45, 21 March 2018

Reaction RXN-9548

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a stearoyl-[acp][c] + 1 H2O[c] => 1 H+[c] + 1 stearate[c] + 1 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_006540&oldid=21319"