Difference between revisions of "DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13910 CPD-13910] == * smiles: ** C1(OC(=O)C(=O)OC(C(O)C(=O)[O-])1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENYLATECYC-RXN ADENYLATECYC-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** adenylate cyc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENYLATECYC-RXN ADENYLATECYC-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** adenylate cyclase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.6.1.1 EC-4.6.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''=>''' 1 [[CAMP]][c] '''+''' 1 [[PPI]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''=>''' 1 cyclic-AMP[c] '''+''' 1 diphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_002930]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15389 15389] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00089 R00089] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14605 P14605] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q05766 Q05766] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P21932 P21932] |
+ | ** [http://www.uniprot.org/uniprot/P19754 P19754] | ||
+ | ** [http://www.uniprot.org/uniprot/P26769 P26769] | ||
+ | ** [http://www.uniprot.org/uniprot/P26770 P26770] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03343 Q03343] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01341 Q01341] | ||
+ | ** [http://www.uniprot.org/uniprot/P40134 P40134] | ||
+ | ** [http://www.uniprot.org/uniprot/P40146 P40146] | ||
+ | ** [http://www.uniprot.org/uniprot/P51829 P51829] | ||
+ | ** [http://www.uniprot.org/uniprot/P49606 P49606] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A1A7 P0A1A7] | ||
+ | ** [http://www.uniprot.org/uniprot/P19485 P19485] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03100 Q03100] | ||
+ | ** [http://www.uniprot.org/uniprot/P32870 P32870] | ||
+ | ** [http://www.uniprot.org/uniprot/Q08462 Q08462] | ||
+ | ** [http://www.uniprot.org/uniprot/P43524 P43524] | ||
+ | ** [http://www.uniprot.org/uniprot/Q44561 Q44561] | ||
+ | ** [http://www.uniprot.org/uniprot/P51830 P51830] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01513 Q01513] | ||
+ | ** [http://www.uniprot.org/uniprot/P40136 P40136] | ||
+ | ** [http://www.uniprot.org/uniprot/P15318 P15318] | ||
+ | ** [http://www.uniprot.org/uniprot/P08678 P08678] | ||
+ | ** [http://www.uniprot.org/uniprot/P23466 P23466] | ||
+ | ** [http://www.uniprot.org/uniprot/P00936 P00936] | ||
+ | ** [http://www.uniprot.org/uniprot/P27580 P27580] | ||
+ | ** [http://www.uniprot.org/uniprot/P40145 P40145] | ||
+ | ** [http://www.uniprot.org/uniprot/P26338 P26338] | ||
+ | ** [http://www.uniprot.org/uniprot/P40130 P40130] | ||
+ | ** [http://www.uniprot.org/uniprot/P30528 P30528] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9QW33 Q9QW33] | ||
+ | ** [http://www.uniprot.org/uniprot/P72951 P72951] | ||
+ | ** [http://www.uniprot.org/uniprot/P40138 P40138] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9VW60 Q9VW60] | ||
+ | ** [http://www.uniprot.org/uniprot/O96306 O96306] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9Z286 Q9Z286] | ||
+ | ** [http://www.uniprot.org/uniprot/O76229 O76229] | ||
+ | ** [http://www.uniprot.org/uniprot/O77079 O77079] | ||
+ | ** [http://www.uniprot.org/uniprot/O96762 O96762] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=adenylate cyclase}} | ||
+ | {{#set: ec number=EC-4.6.1.1}} | ||
+ | {{#set: gene associated=Ec-06_002930}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:45, 21 March 2018
Contents
Reaction ADENYLATECYC-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- adenylate cyclase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] => 1 cyclic-AMP[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_002930
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: