Difference between revisions of "MONOPHENOL-MONOOXYGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == * smiles: ** CC(=O)NCCCC(=O)[O-] * inchi key: ** InChIKey=UZTFMUBKZQVKLK-UHFF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] == * direction: ** LEFT-TO-RIGHT * common name: ** Gamma-glutamyltranspeptidase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] ==
−
* smiles:
+
* direction:
−
** CC(=O)NCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-acetamidobutanoate
+
** Gamma-glutamyltranspeptidase
−
* molecular weight:
+
* ec number:
−
** 144.15   
+
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
 
* Synonym(s):
 
* Synonym(s):
−
** N-acetyl-4-aminobutyrate
 
−
** N-acetyl-γ-aminobutyrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-37]]
+
** 1 [[GLUTATHIONE]][c] '''+''' 1 [[CPD-9699]][c] '''=>''' 1 [[CYS-GLY]][c] '''+''' 1 [[CPD-9700]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 glutathione[c] '''+''' 1 hypoglycin A[c] '''=>''' 1 L-cysteinyl-glycine[c] '''+''' 1 hypoglycin B[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_006220]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826]
 +
** '''4''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991994 6991994]
+
{{#set: common name=Gamma-glutamyltranspeptidase}}
−
* HMDB : HMDB03681
+
{{#set: ec number=EC-2.3.2.2}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-21_006220}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02946 C02946]
+
{{#set: in pathway=PWY-5826}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.5360158.html 5360158]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11951 11951]
+
−
* METABOLIGHTS : MTBLC11951
+
−
{{#set: smiles=CC(=O)NCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-acetamidobutanoate}}
+
−
{{#set: molecular weight=144.15    }}
+
−
{{#set: common name=N-acetyl-4-aminobutyrate|N-acetyl-γ-aminobutyrate}}
+
−
{{#set: produced by=RXN-37}}
+

Revision as of 13:45, 21 March 2018

Reaction RXN-9157

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Gamma-glutamyltranspeptidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 glutathione[c] + 1 hypoglycin A[c] => 1 L-cysteinyl-glycine[c] + 1 hypoglycin B[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5826, hypoglycin biosynthesis: PWY-5826
    • 4 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=MONOPHENOL-MONOOXYGENASE-RXN&oldid=21343"