Difference between revisions of "CD-S-SP-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] == * smiles: ** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O * common name: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7609 RXN-7609] == * direction: ** LEFT-TO-RIGHT * common name: ** 5'-nucleotidase * ec number:...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-659 CPD-659] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7609 RXN-7609] ==
−
* smiles:
+
* direction:
−
** C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** L-arogenate
+
** 5'-nucleotidase
−
* inchi key:
+
* ec number:
−
** InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M
+
** [http://enzyme.expasy.org/EC/3.1.3.5 EC-3.1.3.5]
−
* molecular weight:
+
−
** 226.208   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-arogenic acid
 
−
** pretyrosine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[CYCLOHEXADIENYL-DEHYDROGENASE-RXN]]
+
* With identifiers:
−
* [[RXN-5682]]
+
** 1 [[WATER]][c] '''+''' 1 [[GMP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[GUANOSINE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 GMP[c] '''=>''' 1 phosphate[c] '''+''' 1 guanosine[c]
−
* [[RXN-14476]]
+
 
−
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+
== Genes associated with this reaction  ==
−
* [[PREPHENATE-TRANSAMINE-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-05_000950]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-15_000820]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-12_005060]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6608]], guanosine nucleotides degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-6607]], guanosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-6606]], guanosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6606 PWY-6606]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 53078-86-7
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27714 27714]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244469 25244469]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01227 R01227]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58180 58180]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=5'-nucleotidase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00826 C00826]
+
{{#set: ec number=EC-3.1.3.5}}
−
{{#set: smiles=C(C(CC1(C=CC(C=C1)O)C([O-])=O)[N+])([O-])=O}}
+
{{#set: gene associated=Ec-05_000950|Ec-15_000820|Ec-12_005060}}
−
{{#set: common name=L-arogenate}}
+
{{#set: in pathway=PWY-6608|PWY-6607|PWY-6606}}
−
{{#set: inchi key=InChIKey=MIEILDYWGANZNH-DSQUFTABSA-M}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=226.208    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=L-arogenic acid|pretyrosine}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=CYCLOHEXADIENYL-DEHYDROGENASE-RXN|RXN-5682}}
+
−
{{#set: reversible reaction associated=RXN-14476|PREPHENATE-ASP-TRANSAMINE-RXN|PREPHENATE-TRANSAMINE-RXN}}
+

Revision as of 13:45, 21 March 2018

Reaction RXN-7609

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5'-nucleotidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 GMP[c] => 1 phosphate[c] + 1 guanosine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6608, guanosine nucleotides degradation III: PWY-6608
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-6607, guanosine nucleotides degradation I: PWY-6607
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-6606, guanosine nucleotides degradation II: PWY-6606
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CD-S-SP-Complex&oldid=21368"