Difference between revisions of "L-aspartyl-tRNAAsn"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-00_005850 == * left end position: ** 9316147 * transcription direction: ** NEGATIVE * right end position: ** 9318754 * centisome position: ** 49.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-00_005850 == |
− | * | + | * left end position: |
− | ** | + | ** 9316147 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 9318754 |
− | * | + | * centisome position: |
− | ** | + | ** 49.170982 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0471_0010 |
+ | ** Esi0471_0010 | ||
+ | ** CYP5163A2 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.14.13.79-RXN]] | |
− | * [[ | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[RXN-1121]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-3661]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-4225]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-4231]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-715]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-773]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-8038]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN-8040]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-147]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-148]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-150]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-151]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-160]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[RXN1F-161]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5034]] | ||
+ | * [[PWY-699]] | ||
+ | * [[PWY-7591]] | ||
+ | * [[PWY-2181]] | ||
+ | * [[PWY-2582]] | ||
+ | * [[PWY-5947]] | ||
+ | * [[PWY-5047]] | ||
+ | * [[PWY-5640]] | ||
+ | * [[PWY-5946]] | ||
+ | * [[PWY-5943]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9316147}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=9318754}} | |
− | + | {{#set: centisome position=49.170982 }} | |
− | + | {{#set: common name=Esi_0471_0010|Esi0471_0010|CYP5163A2}} | |
− | + | {{#set: reaction associated=1.14.13.79-RXN|RXN-1121|RXN-3661|RXN-4225|RXN-4231|RXN-715|RXN-773|RXN-8038|RXN-8040|RXN1F-147|RXN1F-148|RXN1F-150|RXN1F-151|RXN1F-160|RXN1F-161|UNSPECIFIC-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5034|PWY-699|PWY-7591|PWY-2181|PWY-2582|PWY-5947|PWY-5047|PWY-5640|PWY-5946|PWY-5943}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 14:45, 21 March 2018
Gene Ec-00_005850
- left end position:
- 9316147
- transcription direction:
- NEGATIVE
- right end position:
- 9318754
- centisome position:
- 49.170982
- Synonym(s):
- Esi_0471_0010
- Esi0471_0010
- CYP5163A2
Reactions associated
- Reaction: 1.14.13.79-RXN
- Source: orthology-aragem
- Reaction: RXN-1121
- Source: orthology-aragem
- Reaction: RXN-3661
- Source: orthology-aragem
- Reaction: RXN-4225
- Source: orthology-aragem
- Reaction: RXN-4231
- Source: orthology-aragem
- Reaction: RXN-715
- Source: orthology-aragem
- Reaction: RXN-773
- Source: orthology-aragem
- Reaction: RXN-8038
- Source: orthology-aragem
- Reaction: RXN-8040
- Source: orthology-aragem
- Reaction: RXN1F-147
- Source: orthology-aragem
- Reaction: RXN1F-148
- Source: orthology-aragem
- Reaction: RXN1F-150
- Source: orthology-aragem
- Reaction: RXN1F-151
- Source: orthology-aragem
- Reaction: RXN1F-160
- Source: orthology-aragem
- Reaction: RXN1F-161
- Source: orthology-aragem
- Reaction: UNSPECIFIC-MONOOXYGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome