Difference between revisions of "L-aspartyl-tRNAAsn"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-00_005850 == * left end position: ** 9316147 * transcription direction: ** NEGATIVE * right end position: ** 9318754 * centisome position: ** 49.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] ==
+
== Gene Ec-00_005850 ==
−
* smiles:
+
* left end position:
−
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** 9316147
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** D-galactonate
+
** 9318754
−
* molecular weight:
+
* centisome position:
−
** 195.149    
+
** 49.170982    
 
* Synonym(s):
 
* Synonym(s):
−
** galactonate
+
** Esi_0471_0010
 +
** Esi0471_0010
 +
** CYP5163A2
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.13.79-RXN]]
−
* [[GALACTONOLACTONASE-RXN]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-1121]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-3661]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-4225]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-4231]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-715]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-773]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8038]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-8040]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-147]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-148]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-150]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-151]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-160]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN1F-161]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5034]]
 +
* [[PWY-699]]
 +
* [[PWY-7591]]
 +
* [[PWY-2181]]
 +
* [[PWY-2582]]
 +
* [[PWY-5947]]
 +
* [[PWY-5047]]
 +
* [[PWY-5640]]
 +
* [[PWY-5946]]
 +
* [[PWY-5943]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9316147}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461127 5461127]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB00565
+
{{#set: right end position=9318754}}
−
* LIGAND-CPD:
+
{{#set: centisome position=49.170982   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00880 C00880]
+
{{#set: common name=Esi_0471_0010|Esi0471_0010|CYP5163A2}}
−
* CHEMSPIDER:
+
{{#set: reaction associated=1.14.13.79-RXN|RXN-1121|RXN-3661|RXN-4225|RXN-4231|RXN-715|RXN-773|RXN-8038|RXN-8040|RXN1F-147|RXN1F-148|RXN1F-150|RXN1F-151|RXN1F-160|RXN1F-161|UNSPECIFIC-MONOOXYGENASE-RXN}}
−
** [http://www.chemspider.com/Chemical-Structure.4574468.html 4574468]
+
{{#set: pathway associated=PWY-5034|PWY-699|PWY-7591|PWY-2181|PWY-2582|PWY-5947|PWY-5047|PWY-5640|PWY-5946|PWY-5943}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12931 12931]
+
−
* BIGG : 36277
+
−
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M}}
+
−
{{#set: common name=D-galactonate}}
+
−
{{#set: molecular weight=195.149   }}
+
−
{{#set: common name=galactonate}}
+
−
{{#set: produced by=GALACTONOLACTONASE-RXN}}
+

Revision as of 13:45, 21 March 2018

Gene Ec-00_005850

  • left end position:
    • 9316147
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 9318754
  • centisome position:
    • 49.170982
  • Synonym(s):
    • Esi_0471_0010
    • Esi0471_0010
    • CYP5163A2

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-aspartyl-tRNAAsn&oldid=21370"