Difference between revisions of "3.5.1.27-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FE+3 FE+3] == * smiles: ** [Fe+++] * inchi key: ** InChIKey=VTLYFUHAOXGGBS-UHFFFAOYSA-N * commo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == |
* smiles: | * smiles: | ||
− | ** [ | + | ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J |
* common name: | * common name: | ||
− | ** | + | ** (7Z)-tetradecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 971.845 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 14:1-Δ7-CoA |
− | ** | + | ** cis-7-tetradecenoyl-CoA |
− | ** | + | ** 14:1(n-7)-CoA |
− | + | ** (7Z)-tetradec-7-enoyl-CoA | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-17792]] | |
− | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}} | |
− | + | {{#set: common name=(7Z)-tetradecenoyl-CoA}} | |
− | + | {{#set: molecular weight=971.845 }} | |
− | + | {{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}} | |
− | + | {{#set: consumed by=RXN-17792}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + | ||
− | + |
Revision as of 13:46, 21 March 2018
Contents
Metabolite CPD-19147
- smiles:
- CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
- common name:
- (7Z)-tetradecenoyl-CoA
- molecular weight:
- 971.845
- Synonym(s):
- 14:1-Δ7-CoA
- cis-7-tetradecenoyl-CoA
- 14:1(n-7)-CoA
- (7Z)-tetradec-7-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.