Difference between revisions of "Ec-13 002660"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7931 RXN-7931] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.3.3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7931 RXN-7931] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C(=O)[O-])C(O)[CH]=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/5.3.3.8 EC-5.3.3.8]
+
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
 +
* common name:
 +
** L-malic semialdehyde
 +
* molecular weight:
 +
** 117.081   
 
* Synonym(s):
 
* Synonym(s):
 +
** (3R)-3-hydroxy-4-oxobutanoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-6002]]
−
** 1 [[CPD-7221]][c] '''<=>''' 1 [[CPD-7222]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3-cis-dodecenoyl-CoA[c] '''<=>''' 1 trans-dodec-2-enoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7291]], oleate &beta;-oxidation (isomerase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7291 PWY-7291]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23716 23716]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
−
* LIGAND-RXN:
+
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04100 R04100]
+
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=L-malic semialdehyde}}
−
{{#set: ec number=EC-5.3.3.8}}
+
{{#set: molecular weight=117.081    }}
−
{{#set: in pathway=PWY-7291}}
+
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-6002}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:47, 21 March 2018

Metabolite CPD-16618

  • smiles:
    • C(C(=O)[O-])C(O)[CH]=O
  • inchi key:
    • InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
  • common name:
    • L-malic semialdehyde
  • molecular weight:
    • 117.081
  • Synonym(s):
    • (3R)-3-hydroxy-4-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_002660&oldid=21585"