Difference between revisions of "Ec-01 007480"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-10_001440 == * left end position: ** 1517720 * transcription direction: ** NEGATIVE * right end position: ** 1527238 * centisome position: ** 23.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == * smiles: ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-C4-DECADIENYL-COA T2-C4-DECADIENYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J |
− | * | + | * common name: |
− | ** | + | ** trans-Δ2, cis-Δ4-decadienoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 913.722 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DIENOYLCOAREDUCT-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658212 90658212] |
− | {{#set: | + | {{#set: smiles=CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J}} |
− | {{#set: | + | {{#set: common name=trans-Δ2, cis-Δ4-decadienoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=913.722 }} |
+ | {{#set: consumed by=DIENOYLCOAREDUCT-RXN}} |
Revision as of 14:47, 21 March 2018
Contents
Metabolite T2-C4-DECADIENYL-COA
- smiles:
- CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=FASAKYLWSRDQOH-IMVFQKDNSA-J
- common name:
- trans-Δ2, cis-Δ4-decadienoyl-CoA
- molecular weight:
- 913.722
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.