Difference between revisions of "RXN3O-4157"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == * smiles: ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8746 RXN-8746] == * direction: ** LEFT-TO-RIGHT * common name: ** Aryldialkylphosphatase * ec n...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8746 RXN-8746] ==
−
* smiles:
+
* direction:
−
** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J
+
 
* common name:
 
* common name:
−
** 3,24-dioxocholest-4-en-26-oyl-CoA
+
** Aryldialkylphosphatase
−
* molecular weight:
+
* ec number:
−
** 1174.098   
+
** [http://enzyme.expasy.org/EC/3.1.8.1 EC-3.1.8.1]
 
* Synonym(s):
 
* Synonym(s):
−
** cholest-4-en--3,24,dione-26-oyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12705]]
+
** 1 [[PARAOXON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[P-NITROPHENOL]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[DIETHYLPHOSPHATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 paraoxon[c] '''+''' 1 H2O[c] '''=>''' 1 4-nitrophenol[c] '''+''' 2 H+[c] '''+''' 1 diethylphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_006880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-5490]], paraoxon degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5490 PWY-5490]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659292 90659292]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05548 R05548]
−
{{#set: smiles=CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J}}
+
{{#set: common name=Aryldialkylphosphatase}}
−
{{#set: common name=3,24-dioxocholest-4-en-26-oyl-CoA}}
+
{{#set: ec number=EC-3.1.8.1}}
−
{{#set: molecular weight=1174.098    }}
+
{{#set: gene associated=Ec-27_006880}}
−
{{#set: common name=cholest-4-en--3,24,dione-26-oyl-CoA}}
+
{{#set: in pathway=PWY-5490}}
−
{{#set: produced by=RXN-12705}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:47, 21 March 2018

Reaction RXN-8746

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Aryldialkylphosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5490, paraoxon degradation: PWY-5490
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN3O-4157&oldid=21609"