Difference between revisions of "2.7.1.140-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(OP([O-])([O-])=O)C([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L |
* common name: | * common name: | ||
− | ** | + | ** 3-phospho-L-serine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 183.057 |
* Synonym(s): | * Synonym(s): | ||
+ | ** O-phospho-L-serine | ||
+ | ** L-serine phosphate | ||
+ | ** phosphoryl-L-serine | ||
+ | ** L-seryl phosphate | ||
+ | ** L-serine-3P | ||
+ | ** L-serine 3-phosphate | ||
+ | ** 3-phospho-L-serine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5114]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PSERTRANSAM-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 407-41-0 | ||
+ | * CAS : 17885-08-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387] |
− | {{#set: smiles=C( | + | * HMDB : HMDB00272 |
− | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005] |
− | {{#set: molecular weight= | + | * CHEMSPIDER: |
− | {{#set: consumed by= | + | ** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524] | ||
+ | * BIGG : 36594 | ||
+ | {{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}} | ||
+ | {{#set: common name=3-phospho-L-serine}} | ||
+ | {{#set: molecular weight=183.057 }} | ||
+ | {{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}} | ||
+ | {{#set: consumed by=RXN0-5114}} | ||
+ | {{#set: reversible reaction associated=PSERTRANSAM-RXN}} |
Revision as of 13:47, 21 March 2018
Contents
Metabolite 3-P-SERINE
- smiles:
- C(OP([O-])([O-])=O)C([N+])C([O-])=O
- inchi key:
- InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
- common name:
- 3-phospho-L-serine
- molecular weight:
- 183.057
- Synonym(s):
- O-phospho-L-serine
- L-serine phosphate
- phosphoryl-L-serine
- L-seryl phosphate
- L-serine-3P
- L-serine 3-phosphate
- 3-phospho-L-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 407-41-0
- CAS : 17885-08-4
- PUBCHEM:
- HMDB : HMDB00272
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 36594
"C(OP([O-])([O-])=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.