Difference between revisions of "NITRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15007 RXN-15007] == * direction: ** REVERSIBLE * common name: ** Aminotransferase class-III * e...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15007 RXN-15007] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Aminotransferase class-III |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.11 EC-2.6.1.11] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[LysW-L-ornithine]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[LysW-L-glutamate-5-semialdehyde]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 an [L-2-aminoadipate carrier protein]-L-ornithine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-14_006580]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-7400]], L-arginine biosynthesis IV (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7400 PWY-7400] | ||
| + | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Aminotransferase class-III}} | |
| − | + | {{#set: ec number=EC-2.6.1.11}} | |
| − | + | {{#set: gene associated=Ec-14_006580}} | |
| − | + | {{#set: in pathway=PWY-7400}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:47, 21 March 2018
Contents
Reaction RXN-15007
- direction:
- REVERSIBLE
- common name:
- Aminotransferase class-III
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 LysW-L-ornithine[c] + 1 2-KETOGLUTARATE[c] <=> 1 GLT[c] + 1 LysW-L-glutamate-5-semialdehyde[c]
- With common name(s):
- 1 an [L-2-aminoadipate carrier protein]-L-ornithine[c] + 1 2-oxoglutarate[c] <=> 1 L-glutamate[c] + 1 an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-14_006580
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-7400, L-arginine biosynthesis IV (archaebacteria): PWY-7400
- 7 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
