Difference between revisions of "RXN0-7239"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-1-SEMIALDEHYDE GLUTAMATE-1-SEMIALDEHYDE] == * smiles: ** [CH](C(CCC([O-])=O)[N+])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * smiles: ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L |
* common name: | * common name: | ||
| − | ** ( | + | ** 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 350.235 |
* Synonym(s): | * Synonym(s): | ||
| − | ** L- | + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate |
| + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate | ||
| + | ** 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate | ||
| + | ** unsaturated digalacturonate | ||
| + | ** 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid | ||
| + | ** 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14897]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878600 46878600] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60189 60189] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04733 C04733] |
| − | {{#set: smiles=[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06118 C06118] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))}} |
| − | {{#set: common name=( | + | {{#set: inchi key=InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate}} |
| − | {{#set: common name=L- | + | {{#set: molecular weight=350.235 }} |
| − | + | {{#set: common name=4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate|4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate|4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate|unsaturated digalacturonate|4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid|4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid}} | |
| − | {{#set: produced by= | + | {{#set: produced by=RXN-14897}} |
Revision as of 13:48, 21 March 2018
Contents
Metabolite CPD-11241
- smiles:
- C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))
- inchi key:
- InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L
- common name:
- 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate
- molecular weight:
- 350.235
- Synonym(s):
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate
- 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate
- unsaturated digalacturonate
- 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid
- 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))" cannot be used as a page name in this wiki.
