Difference between revisions of "GLUTAMATE-1-SEMIALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...")
(Created page with "Category:Gene == Gene Ec-10_001380 == * left end position: ** 1488712 * transcription direction: ** POSITIVE * right end position: ** 1490288 * centisome position: ** 22.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] ==
+
== Gene Ec-10_001380 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C1(C=CC(=CC=1)N)
+
** 1488712
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-aminobenzoate
+
** 1490288
−
* molecular weight:
+
* centisome position:
−
** 136.13    
+
** 22.899792    
 
* Synonym(s):
 
* Synonym(s):
−
** para-aminobenzoic acid
+
** Esi_0073_0112
−
** p-aminobenzoic acid
+
** Esi0073_0112
−
** para-aminobenzoate
+
−
** p-aminobenzoate
+
−
** 4-aminobenzoic acid
+
−
** pABA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[H2PTEROATESYNTH-RXN]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[ADCLY-RXN]]
+
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1335]]
 +
* [[PWY0-1334]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* CAS : 150-13-0
+
{{#set: left end position=1488712}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876]
+
{{#set: right end position=1490288}}
−
* HMDB : HMDB01392
+
{{#set: centisome position=22.899792   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0073_0112|Esi0073_0112}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568]
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1335|PWY0-1334|PWY-4302}}
−
** [http://www.chemspider.com/Chemical-Structure.4710.html 4710]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836]
+
−
* BIGG : 35376
+
−
{{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}}
+
−
{{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-aminobenzoate}}
+
−
{{#set: molecular weight=136.13   }}
+
−
{{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}}
+
−
{{#set: consumed by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: reversible reaction associated=ADCLY-RXN}}
+

Revision as of 13:48, 21 March 2018

Gene Ec-10_001380

  • left end position:
    • 1488712
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1490288
  • centisome position:
    • 22.899792
  • Synonym(s):
    • Esi_0073_0112
    • Esi0073_0112

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLUTAMATE-1-SEMIALDEHYDE&oldid=21725"