Difference between revisions of "Cis-delta19-3-oxo-C38-ACPs"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDROGENASE-NADP+-RXN GLYCEROL-DEHYDROGENASE-NADP+-RXN] == * direction: ** REVERSIBLE *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
− | * | + | * common name: |
− | ** | + | ** 3,8-divinyl protochlorophyllide a |
− | ** | + | * molecular weight: |
+ | ** 608.935 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** divinylprotochlorophyllide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-5285]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632] | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831] | |
− | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
− | {{#set: | + | {{#set: common name=3,8-divinyl protochlorophyllide a}} |
− | {{#set: | + | {{#set: molecular weight=608.935 }} |
− | {{#set: | + | {{#set: common name=divinylprotochlorophyllide}} |
+ | {{#set: consumed by=RXN-5285}} |
Revision as of 13:48, 21 March 2018
Contents
Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- 3,8-divinyl protochlorophyllide a
- molecular weight:
- 608.935
- Synonym(s):
- divinylprotochlorophyllide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.