Difference between revisions of "OLEOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] == * smiles: ** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Ec-05_002890 == * left end position: ** 4568711 * transcription direction: ** NEGATIVE * right end position: ** 4573301 * centisome position: ** 50.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15684 CPD-15684] ==
+
== Gene Ec-05_002890 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4568711
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5-cis, 7-trans-tetradecadienoyl-CoA
+
** 4573301
−
* molecular weight:
+
* centisome position:
−
** 969.83    
+
** 50.186287    
 
* Synonym(s):
 
* Synonym(s):
−
** 5Z, 7E-tetradecadienoyl-CoA
+
** Esi_0004_0227
 +
** Esi0004_0227
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14796]]
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4568711}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659270 90659270]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CC=CCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=4573301}}
−
{{#set: inchi key=InChIKey=AMANZGDVBADZLH-QTJPLKLFSA-J}}
+
{{#set: centisome position=50.186287   }}
−
{{#set: common name=5-cis, 7-trans-tetradecadienoyl-CoA}}
+
{{#set: common name=Esi_0004_0227|Esi0004_0227}}
−
{{#set: molecular weight=969.83   }}
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: common name=5Z, 7E-tetradecadienoyl-CoA}}
+
−
{{#set: consumed by=RXN-14796}}
+

Revision as of 13:48, 21 March 2018

Gene Ec-05_002890

  • left end position:
    • 4568711
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4573301
  • centisome position:
    • 50.186287
  • Synonym(s):
    • Esi_0004_0227
    • Esi0004_0227

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=OLEOYL-COA&oldid=21833"