Difference between revisions of "C1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] == * smiles: ** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)...")
(Created page with "Category:Gene == Gene Ec-08_000860 == * left end position: ** 851507 * transcription direction: ** NEGATIVE * right end position: ** 864783 * centisome position: ** 12.714...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16475 CPD-16475] ==
+
== Gene Ec-08_000860 ==
−
* smiles:
+
* left end position:
−
** CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)
+
** 851507
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine
+
** 864783
−
* molecular weight:
+
* centisome position:
−
** 529.494    
+
** 12.714627    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine
+
** Esi_0214_0024
−
** Lewis x epitope
+
** Esi0214_0024
−
** Lex epitope
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.2.2.10-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15268]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14897]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7243]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=851507}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11813424 11813424]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=864783}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62287 62287]
+
{{#set: centisome position=12.714627   }}
−
{{#set: smiles=CC3(C(O)C(O)C(O)C(OC2(C(NC(C)=O)C(O)OC(CO)C(OC1(OC(CO)C(O)C(O)C(O)1))2))O3)}}
+
{{#set: common name=Esi_0214_0024|Esi0214_0024}}
−
{{#set: inchi key=InChIKey=HBBOZFUQJDYASD-QGTNPELVSA-N}}
+
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
−
{{#set: common name=β-D-galactosyl-(1→4)-[α-L-fucosyl-(1→3)]-N-acetyl-β-D-glucosamine}}
+
{{#set: pathway associated=PWY-7243}}
−
{{#set: molecular weight=529.494   }}
+
−
{{#set: common name=β-D-galactosyl-1,4-[α-L-fucosyl-1,3]-N-acetyl-D-glucosamine|Lewis x epitope|Lex epitope}}
+
−
{{#set: reversible reaction associated=RXN-15268}}
+

Revision as of 13:48, 21 March 2018

Gene Ec-08_000860

  • left end position:
    • 851507
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 864783
  • centisome position:
    • 12.714627
  • Synonym(s):
    • Esi_0214_0024
    • Esi0214_0024

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=C1&oldid=21842"