Difference between revisions of "CPD-7221"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrogenas...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] ==
−
* smiles:
+
* direction:
−
** C(NC(N)=O)CCC([N+])C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RHGKLRLOHDJJDR-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
−
** L-citrulline
+
** 6-phosphogluconate dehydrogenase, C-terminal-like
−
* molecular weight:
+
** 3-hydroxyacyl-CoA dehydrogenase
−
** 175.187   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** Nγ-carbamylornithine
 
−
** α-amino-γ-ureidovaleric acid
 
−
** γureidonorvaline
 
−
** N5-(Aminocarbonyl)-L-ornithine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[ARGSUCCINSYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CARBOXYMETHYL-HYDROXYPHENYLPROPCOA]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[BENZOYLSUCCINYL-COA]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-13482]]
+
** 1 2-carboxymethyl-3-hydroxyphenylpropanoyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 benzoylsuccinyl-CoA[c] '''+''' 1 H+[c]
−
* [[ORNCARBAMTRANSFER-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-19_005290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-81]], toluene degradation to benzoyl-CoA (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-81 PWY-81]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 372-75-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 34627
+
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
−
* DRUGBANK : DB00155
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.35}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992098 6992098]
+
{{#set: gene associated=Ec-14_006530|Ec-19_005290}}
−
* HMDB : HMDB00904
+
{{#set: in pathway=PWY-81}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00327 C00327]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57743 57743]
+
−
* METABOLIGHTS : MTBLC16349
+
−
{{#set: smiles=C(NC(N)=O)CCC([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RHGKLRLOHDJJDR-BYPYZUCNSA-N}}
+
−
{{#set: common name=L-citrulline}}
+
−
{{#set: molecular weight=175.187    }}
+
−
{{#set: common name=Nγ-carbamylornithine|α-amino-γ-ureidovaleric acid|γureidonorvaline|N5-(Aminocarbonyl)-L-ornithine}}
+
−
{{#set: consumed by=ARGSUCCINSYN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-13482|ORNCARBAMTRANSFER-RXN}}
+

Revision as of 13:48, 21 March 2018

Reaction RXN-905

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 6-phosphogluconate dehydrogenase, C-terminal-like
    • 3-hydroxyacyl-CoA dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-81, toluene degradation to benzoyl-CoA (anaerobic): PWY-81
    • 2 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7221&oldid=21845"