Difference between revisions of "Ec-08 003010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-hydroxy-2-methyl-2-(E)-bute...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
** 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate synthase, chloroplast precursor
−
* molecular weight:
+
* ec number:
−
** 1013.883   
+
** [http://enzyme.expasy.org/EC/1.17.7.1 EC-1.17.7.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ7-CoA
 
−
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17781]]
+
** 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H+[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-03_003610]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R08689 R08689]
−
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=1013.883    }}
+
{{#set: common name=1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate synthase, chloroplast precursor}}
−
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
{{#set: ec number=EC-1.17.7.1}}
−
{{#set: produced by=RXN-17781}}
+
{{#set: gene associated=Ec-03_003610}}
 +
{{#set: in pathway=PWY-7560}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 13:49, 21 March 2018

Reaction RXN0-882

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-hydroxy-2-methyl-2-(E)-butenyl 4-diphosphate synthase, chloroplast precursor
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7560, methylerythritol phosphate pathway II: PWY-7560
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_003010&oldid=21900"