Difference between revisions of "GTPPYPHOSKIN-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_000240 == * left end position: ** 277129 * transcription direction: ** POSITIVE * right end position: ** 282540 * centisome position: ** 5.3744...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 3'-ketolactose |
| − | * | + | * molecular weight: |
| − | ** | + | ** 340.283 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[KETOLACTOSE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571] |
| − | {{#set: | + | * KEGG-GLYCAN : G10531 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403] |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057] | ||
| + | * HMDB : HMDB01030 | ||
| + | {{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}} | ||
| + | {{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}} | ||
| + | {{#set: common name=3'-ketolactose}} | ||
| + | {{#set: molecular weight=340.283 }} | ||
| + | {{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}} | ||
| + | {{#set: consumed by=KETOLACTOSE-RXN}} | ||
Revision as of 13:49, 21 March 2018
Contents
Metabolite 3-KETOLACTOSE
- smiles:
- C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
- inchi key:
- InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
- common name:
- 3'-ketolactose
- molecular weight:
- 340.283
- Synonym(s):
- 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
