Difference between revisions of "Ec-06 000970"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1281 RXN0-1281] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrouridine synthase **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1281 RXN0-1281] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
 
* common name:
 
* common name:
−
** dihydrouridine synthase
+
** ergost-7-enol
−
** tRNA-dihydrouridine synthase
+
* molecular weight:
−
** FAD binding / catalytic/ tRNA dihydrouridine synthase
+
** 400.687   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13883]]
−
** 1 [[tRNA-uridines]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[tRNA-Dihydrouridines]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a uridine in tRNA[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a 5,6-dihydrouridine in tRNA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_010520]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-01_000230]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-18_002590]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 516-78-9
−
{{#set: common name=dihydrouridine synthase}}
+
* PUBCHEM:
−
{{#set: common name=tRNA-dihydrouridine synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657800 90657800]
−
{{#set: common name=FAD binding / catalytic/ tRNA dihydrouridine synthase}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: ec number=EC-1.1.1}}
+
{{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}}
−
{{#set: gene associated=Ec-01_010520|Ec-01_000230|Ec-18_002590}}
+
{{#set: common name=ergost-7-enol}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=400.687    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-13883}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:49, 21 March 2018

Metabolite CPD-14893

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
  • common name:
    • ergost-7-enol
  • molecular weight:
    • 400.687
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_000970&oldid=21981"