Difference between revisions of "ALA-tRNAs"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-ASP-TRANSAMINE-RXN PREPHENATE-ASP-TRANSAMINE-RXN] == * direction: ** REVERSIBLE * ec num...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M |
+ | * common name: | ||
+ | ** gibberellin A34 | ||
+ | * molecular weight: | ||
+ | ** 347.387 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA34 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-6550]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0104170025 |
− | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868] |
− | {{#set: | + | {{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}} |
− | {{#set: | + | {{#set: common name=gibberellin A34}} |
− | {{#set: | + | {{#set: molecular weight=347.387 }} |
+ | {{#set: common name=GA34}} | ||
+ | {{#set: produced by=RXN-6550}} |
Revision as of 14:50, 21 March 2018
Contents
Metabolite CPD-6224
- smiles:
- C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- inchi key:
- InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
- common name:
- gibberellin A34
- molecular weight:
- 347.387
- Synonym(s):
- GA34
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.