Difference between revisions of "QUINOPRIBOTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE_ACETALDEHYDE IMIDAZOLE_ACETALDEHYDE] == * smiles: ** C1(NC=NC(CC=O)=1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I |
* common name: | * common name: | ||
− | ** | + | ** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 966.676 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** succinylbenzoyl-CoA |
+ | ** 2-succinylbenzoyl-CoA | ||
+ | ** 2-(3'-carboxypropionyl)benzoyl-CoA | ||
+ | ** o-succinylbenzoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NAPHTHOATE-SYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509] |
− | * | + | * BIGG : 41314 |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160] |
− | {{#set: common name= | + | {{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}} |
− | {{#set: common name= | + | {{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=966.676 }} |
+ | {{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}} | ||
+ | {{#set: consumed by=NAPHTHOATE-SYN-RXN}} |
Revision as of 13:50, 21 March 2018
Contents
Metabolite CPD-6972
- smiles:
- CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
- inchi key:
- InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
- common name:
- 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
- molecular weight:
- 966.676
- Synonym(s):
- succinylbenzoyl-CoA
- 2-succinylbenzoyl-CoA
- 2-(3'-carboxypropionyl)benzoyl-CoA
- o-succinylbenzoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O" cannot be used as a page name in this wiki.