Difference between revisions of "Ec-11 001530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z-3-oxo-tetradec-5-enoyl-ACPs 5Z-3-oxo-tetradec-5-enoyl-ACPs] == * common name: ** a (5Z)-3-ox...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z-3-oxo-tetradec-5-enoyl-ACPs 5Z-3-oxo-tetradec-5-enoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (5Z)-3-oxo-tetradec-5-enoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 3-oxo-cis-Δ5-tetradecenoyl-[acp] |
| + | ** a 3-oxo-cis-tetradec-5-enoyl-[acp] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16616]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16615]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a (5Z)-3-oxo-tetradec-5-enoyl-[acp]}} | |
| − | + | {{#set: common name=a 3-oxo-cis-Δ5-tetradecenoyl-[acp]|a 3-oxo-cis-tetradec-5-enoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-16616}} | |
| − | + | {{#set: produced by=RXN-16615}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 13:50, 21 March 2018
Contents
Metabolite 5Z-3-oxo-tetradec-5-enoyl-ACPs
- common name:
- a (5Z)-3-oxo-tetradec-5-enoyl-[acp]
- Synonym(s):
- a 3-oxo-cis-Δ5-tetradecenoyl-[acp]
- a 3-oxo-cis-tetradec-5-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (5Z)-3-oxo-tetradec-5-enoyl-[acp" cannot be used as a page name in this wiki.
- "a 3-oxo-cis-Δ5-tetradecenoyl-[acp" cannot be used as a page name in this wiki.
- "a 3-oxo-cis-tetradec-5-enoyl-[acp" cannot be used as a page name in this wiki.
