Difference between revisions of "6PFRUCTPHOS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
(Created page with "Category:Gene == Gene Ec-07_006520 == * left end position: ** 6277642 * transcription direction: ** NEGATIVE * right end position: ** 6284700 * centisome position: ** 81.2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_006520 == |
− | * | + | * left end position: |
− | ** | + | ** 6277642 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6284700 |
− | * | + | * centisome position: |
− | ** | + | ** 81.29102 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0110_0056 |
− | ** | + | ** Esi0110_0056 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6277642}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6284700}} | |
− | + | {{#set: centisome position=81.29102 }} | |
− | + | {{#set: common name=Esi_0110_0056|Esi0110_0056}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:50, 21 March 2018
Gene Ec-07_006520
- left end position:
- 6277642
- transcription direction:
- NEGATIVE
- right end position:
- 6284700
- centisome position:
- 81.29102
- Synonym(s):
- Esi_0110_0056
- Esi0110_0056
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome