Difference between revisions of "Ec-06 000810"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBAMATE-KINASE-RXN CARBAMATE-KINASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://en...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBAMATE-KINASE-RXN CARBAMATE-KINASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.2.2 EC-2.7.2.2] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[1 | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[AMMONIUM]][c] '''<=>''' 1 [[CARBAMOYL-P]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 CO2[c] '''+''' 1 ammonium[c] '''<=>''' 1 carbamoyl phosphate[c] '''+''' 2 H+[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY0-41]], allantoin degradation IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-41 PWY0-41] |
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[CITRULLINE-DEG-PWY]], L-citrulline degradation: [http://metacyc.org/META/NEW-IMAGE?object=CITRULLINE-DEG-PWY CITRULLINE-DEG-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10152 10152] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00150 R00150] | |
− | ** [http:// | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/Q9CE17 Q9CE17] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q46807 Q46807] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q8XCV5 Q8XCV5] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CE16 Q9CE16] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P77624 P77624] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q8X6A8 Q8X6A8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44769 P44769] |
− | * | + | ** [http://www.uniprot.org/uniprot/P37306 P37306] |
− | + | ** [http://www.uniprot.org/uniprot/Q9CEY7 Q9CEY7] | |
− | + | ** [http://www.uniprot.org/uniprot/P13982 P13982] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A2X8 P0A2X8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P78030 P78030] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P74733 P74733] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q48295 Q48295] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O53090 O53090] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
+ | {{#set: ec number=EC-2.7.2.2}} | ||
+ | {{#set: in pathway=PWY0-41|CITRULLINE-DEG-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 13:50, 21 March 2018
Contents
Reaction CARBAMATE-KINASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 CARBON-DIOXIDE[c] + 1 AMMONIUM[c] <=> 1 CARBAMOYL-P[c] + 2 PROTON[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 CO2[c] + 1 ammonium[c] <=> 1 carbamoyl phosphate[c] + 2 H+[c] + 1 ADP[c]
Genes associated with this reaction
Pathways
- PWY0-41, allantoin degradation IV (anaerobic): PWY0-41
- 2 reactions found over 6 reactions in the full pathway
- CITRULLINE-DEG-PWY, L-citrulline degradation: CITRULLINE-DEG-PWY
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: