Difference between revisions of "SPERMIDINESYN-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_003280 == * left end position: ** 4244374 * transcription direction: ** NEGATIVE * right end position: ** 4248288 * centisome position: ** 57.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * inchi key: *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (R)-mevalonate diphosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 304.087 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** mevalonate-5-PP |
| − | ** | + | ** (R)-5-diphosphomevalonate |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 4872-34-8 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143] |
| + | * HMDB : HMDB01090 | ||
| + | {{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}} | ||
| + | {{#set: common name=(R)-mevalonate diphosphate}} | ||
| + | {{#set: molecular weight=304.087 }} | ||
| + | {{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}} | ||
| + | {{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}} | ||
| + | {{#set: reversible reaction associated=PHOSPHOMEVALONATE-KINASE-RXN}} | ||
Revision as of 13:50, 21 March 2018
Contents
Metabolite CPD-641
- smiles:
- CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]
- inchi key:
- InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J
- common name:
- (R)-mevalonate diphosphate
- molecular weight:
- 304.087
- Synonym(s):
- mevalonate-5-PP
- (R)-5-diphosphomevalonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-" cannot be used as a page name in this wiki.
