Difference between revisions of "BIOTIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-11_001530 == * left end position: ** 1613351 * transcription direction: ** NEGATIVE * right end position: ** 1613518 * centisome position: ** 25.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Gene Ec-11_001530 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
** 1613351
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** β-D-ribose 5-phosphate
+
** 1613518
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 25.650852    
 
* Synonym(s):
 
* Synonym(s):
−
** β-D-ribofuranose 5-phosphate
+
** Esi_0119_0091
−
** 5-O-phosphono-β-D-ribofuranose
+
** Esi0119_0091
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15346]]
+
* Reaction: [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-15345]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11329]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-15288]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-17352]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
* Reaction: [[RXN-8635]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6824]]
 +
* [[PWY-7445]]
 +
* [[PWY-5469]]
 +
* [[PWY-5466]]
 +
* [[PWY-5461]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1613351}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=1613518}}
−
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
+
{{#set: centisome position=25.650852   }}
−
* CHEBI:
+
{{#set: common name=Esi_0119_0091|Esi0119_0091}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
+
{{#set: reaction associated=PEROXID-RXN|RXN-11329|RXN-14240|RXN-15288|RXN-17352|RXN-8635}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: pathway associated=PWY-7214|PWY-6824|PWY-7445|PWY-5469|PWY-5466|PWY-5461}}
−
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
+
−
{{#set: common name=β-D-ribose 5-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
+
−
{{#set: consumed by=RXN-15346}}
+
−
{{#set: produced by=RXN-15345}}
+

Revision as of 13:50, 21 March 2018

Gene Ec-11_001530

  • left end position:
    • 1613351
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1613518
  • centisome position:
    • 25.650852
  • Synonym(s):
    • Esi_0119_0091
    • Esi0119_0091

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=BIOTIN&oldid=22090"