Difference between revisions of "Ec-26 001670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
(Created page with "Category:Gene == Gene Ec-03_002280 == * left end position: ** 2779795 * transcription direction: ** POSITIVE * right end position: ** 2785234 * centisome position: ** 42.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
+
== Gene Ec-03_002280 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2779795
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pimeloyl-CoA
+
** 2785234
−
* molecular weight:
+
* centisome position:
−
** 904.649    
+
** 42.578335    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-carboxyhexanoyl-CoA
+
** Esi_0011_0091
−
** pimelyl-CoA
+
** Esi0011_0091
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[7KAPSYN-RXN]]
+
* Reaction: [[2.4.1.151-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7434]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2779795}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2785234}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
+
{{#set: centisome position=42.578335   }}
−
* BIGG : 36728
+
{{#set: common name=Esi_0011_0091|Esi0011_0091}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.4.1.151-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
+
{{#set: pathway associated=PWY-7434}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
+
−
{{#set: common name=pimeloyl-CoA}}
+
−
{{#set: molecular weight=904.649   }}
+
−
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
+
−
{{#set: consumed by=7KAPSYN-RXN}}
+

Revision as of 13:50, 21 March 2018

Gene Ec-03_002280

  • left end position:
    • 2779795
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2785234
  • centisome position:
    • 42.578335
  • Synonym(s):
    • Esi_0011_0091
    • Esi0011_0091

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-26_001670&oldid=22138"