Difference between revisions of "RXN-15881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7968 RXN-7968] == * direction: ** LEFT-TO-RIGHT * common name: ** shikimate 3-dehydrogenase (NA...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7968 RXN-7968] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C=CC([O-])=O
 +
* inchi key:
 +
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
 
* common name:
 
* common name:
−
** shikimate 3-dehydrogenase (NADP+)
+
** maleate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.282 EC-1.1.1.282]
+
** 114.057   
 
* Synonym(s):
 
* Synonym(s):
 +
** maleic acid
 +
** cis-butenedioic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[SHIKIMATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[3-DEHYDRO-SHIKIMATE]][c]
+
* [[RXN-646]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 shikimate[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 H+[c] '''+''' 1 NAD(P)H[c] '''+''' 1 3-dehydroshikimate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_006010]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CAS : 110-16-7
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17744 17744]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
−
{{#set: common name=shikimate 3-dehydrogenase (NADP+)}}
+
* HMDB : HMDB00176
−
{{#set: ec number=EC-1.1.1.282}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Ec-02_006010}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
−
{{#set: in pathway=PWY-6163}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
 +
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
 +
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
 +
{{#set: common name=maleate}}
 +
{{#set: molecular weight=114.057    }}
 +
{{#set: common name=maleic acid|cis-butenedioic acid}}
 +
{{#set: produced by=RXN-646}}

Revision as of 13:51, 21 March 2018

Metabolite MALEATE

  • smiles:
    • C([O-])(=O)C=CC([O-])=O
  • inchi key:
    • InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
  • common name:
    • maleate
  • molecular weight:
    • 114.057
  • Synonym(s):
    • maleic acid
    • cis-butenedioic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C=CC([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15881&oldid=22165"