Difference between revisions of "MALEATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Succi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.4.3.16 EC-1.4.3.16] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[L-ASPARTATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[IMINOASPARTATE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 L-aspartate[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 2-iminosuccinate[c] '''+''' 1 hydrogen peroxide[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Ec-05_003640]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5316]], nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316] | ||
+ | ** '''3''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7342]], superpathway of nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342] | ||
+ | ** '''4''' reactions found over '''13''' reactions in the full pathway | ||
+ | * [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25876 25876] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00481 R00481] |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00357 R00357] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}} |
− | + | {{#set: ec number=EC-1.4.3.16}} | |
− | ** [http://www. | + | {{#set: gene associated=Ec-05_003640}} |
− | + | {{#set: in pathway=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:51, 21 March 2018
Contents
Reaction L-ASPARTATE-OXID-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-ASPARTATE[c] + 1 OXYGEN-MOLECULE[c] => 1 PROTON[c] + 1 IMINOASPARTATE[c] + 1 HYDROGEN-PEROXIDE[c]
- With common name(s):
- 1 L-aspartate[c] + 1 oxygen[c] => 1 H+[c] + 1 2-iminosuccinate[c] + 1 hydrogen peroxide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-05_003640
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5316, nicotine biosynthesis: PWY-5316
- 3 reactions found over 9 reactions in the full pathway
- PWY-7342, superpathway of nicotine biosynthesis: PWY-7342
- 4 reactions found over 13 reactions in the full pathway
- PYRIDNUCSYN-PWY, NAD biosynthesis I (from aspartate): PYRIDNUCSYN-PWY
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links