Difference between revisions of "Ec-00 011490"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-724 RXN0-724] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-triphosphate r...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) * inc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) |
+ | * inchi key: | ||
+ | ** InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine |
− | * | + | * molecular weight: |
− | ** | + | ** 378.312 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc | ||
+ | ** 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose | ||
+ | ** 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine | ||
+ | ** chondroitin disaccharide (unsulfated) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12178]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878429 46878429] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57850 57850] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01310 C01310] |
− | {{#set: | + | {{#set: smiles=CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M}} |
+ | {{#set: common name=4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine}} | ||
+ | {{#set: molecular weight=378.312 }} | ||
+ | {{#set: common name=4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc|3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose|3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine|chondroitin disaccharide (unsulfated)}} | ||
+ | {{#set: consumed by=RXN-12178}} |
Revision as of 13:51, 21 March 2018
Contents
Metabolite CPD-36
- smiles:
- CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)
- inchi key:
- InChIKey=DLGJWSVWTWEWBJ-ZTVLJYEESA-M
- common name:
- 4-deoxy-β-D-gluc-4-enuronosyl-(1,3)-N-acetyl-D-galactosamine
- molecular weight:
- 378.312
- Synonym(s):
- 4-deoxy-Δ4,5-β-D-GlcAp-(1→3)-β-D-GalNAc
- 3-(4-deoxy-α-L-threo-hex-4-enopyranosyluronic acid)-2-acetamido-2-deoxy-D-galactose
- 3-(4-deoxy-β-D-gluc-4-enuronosyl)-N-acetyl-D-galactosamine
- chondroitin disaccharide (unsulfated)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2)" cannot be used as a page name in this wiki.